CAS 195442-55-8

4-amino-8-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl]-6-methyl-pteridin-7-one

Description:

4-amino-8-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl]-6-methyl-pteridin-7-one, with the CAS number 195442-55-8, is a chemical compound that belongs to the class of pteridines, which are bicyclic compounds containing a pyrimidine and a pyrazine ring. This substance features an amino group and a hydroxymethyl-substituted tetrahydrofuran moiety, contributing to its potential biological activity. The presence of the hydroxyl groups suggests that it may exhibit hydrogen bonding capabilities, influencing its solubility and reactivity. The compound's structure indicates it may interact with biological systems, potentially serving as a precursor or an active agent in pharmaceutical applications. Its stereochemistry, particularly the (2R,4R,5R) configuration, is crucial for its biological function, as stereoisomers can exhibit significantly different properties. Overall, this compound's unique structural features may make it of interest in medicinal chemistry and drug development, particularly in the context of targeting specific biological pathways or mechanisms.

Formula: C₁₂H₁₅N₅O₄

InChI: InChI=1/C12H15N5O4/c1-5-12(20)17(8-2-6(19)7(3-18)21-8)11-9(16-5)10(13)14-4-15-11/h4,6-8,18-19H,2-3H2,1H3,(H2,13,14,15)/t6-,7-,8-/m1/s1

SMILES: Cc1c(=O)n([C@H]2C[C@H]([C@@H](CO)O2)O)c2c(c(N)ncn2)n1

4-Amino-6-methyl-8-(2-deoxy-β-D-ribofuranosyl)-7(8H)-pteridone

CAS: 195442-55-8

Molecular weight: 293.28

Ref: 7W-GT6068

4-Amino-6-methyl-8-(2'-deoxy-b-D-ribofuranosyl)-7-pteridone

CAS: 195442-55-8

4-Amino-6-methyl-8-(2'-deoxy-b-D-ribofuranosyl)-7-pteridone (4AMD) is an adenosine analog that is fluorescent. 4AMD is not hydrolyzed by adenosine deaminase and has a higher affinity for the A1 receptor than for the A2a receptor. This makes it a useful probe for the study of adenosine mediated, yields, and analogs. The fluorescence properties of 4AMD were studied in different solvents at various temperatures to monitor the interaction of 4AMD with catalysis. The monomeric form of 4AMD was used to measure its fluorescence properties.

Formula: C₁₂H₁₅N₅O₄

Purity: Min. 95%

Molecular weight: 293.28 g/mol

Ref: 3D-NA04481