CAS 19547-88-7
:N,S-Diacetyl-L-cysteine methyl ester
Description:
N,S-Diacetyl-L-cysteine methyl ester, with the CAS number 19547-88-7, is a derivative of the amino acid L-cysteine. This compound features two acetyl groups attached to the nitrogen and sulfur atoms of the cysteine backbone, which enhances its solubility and stability compared to its parent compound. It is typically a white to off-white crystalline solid and is soluble in polar solvents such as water and methanol. The presence of the acetyl groups contributes to its reactivity, making it useful in various biochemical applications, including as a precursor in the synthesis of other compounds and as a potential antioxidant. Additionally, it may exhibit biological activities related to its thiol group, which can participate in redox reactions. N,S-Diacetyl-L-cysteine methyl ester is often studied for its potential therapeutic applications, particularly in the context of cellular protection and detoxification processes. As with many chemical substances, proper handling and safety precautions should be observed due to its reactivity and potential biological effects.
Formula:C8H13NO4S
InChI:InChI=1S/C8H13NO4S/c1-5(10)9-7(8(12)13-3)4-14-6(2)11/h7H,4H2,1-3H3,(H,9,10)/t7-/m0/s1
InChI key:InChIKey=AIDHMQPGKCFCHV-ZETCQYMHSA-N
SMILES:[C@@H](C(OC)=O)(CSC(C)=O)NC(C)=O
Synonyms:- <span class="text-smallcaps">L</span>-Cysteine, N,S-diacetyl-, methyl ester
- <span class="text-smallcaps">L</span>-Cysteine, N-acetyl-, methyl ester, acetate (ester)
- Acetic acid, thio-, S-ester with N-acetyl-<span class="text-smallcaps">L</span>-cysteine methyl ester
- Cysteine, N-acetyl-, methyl ester, acetate (ester), <span class="text-smallcaps">L</span>-
- Methyl N,S-diacetyl-L-cysteinate
- Mucothiol
- N,S-Diacetyl-<span class="text-smallcaps">L</span>-cysteine methyl ester
- N,S-Diacetylcysteine methyl ester
- L-Cysteine, N-acetyl-, methyl ester, acetate (ester)
- Acetic acid, thio-, S-ester with N-acetyl-L-cysteine methyl ester
- N,S-Diacetyl-L-cysteine methyl ester
- L-Cysteine, N,S-diacetyl-, methyl ester
- Cysteine, N-acetyl-, methyl ester, acetate (ester), L-
- Einecs 243-146-2
- N,S-Diacetylcysteine methyl ester USP/EP/BP
- (R)-methyl 2-acetamido-3-(acetylthio)propanoate
- n,s-diacetylcysteinemethylester
- methyl (2R)-3-(acetylsulfanyl)-2-acetamidopropanoate
- Acetylcysteine Impurity 25
- L-Cysteine, N-acetyl-,methyl ester, acetate (ester) (9CI)
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
N,S-Diacetyl-L-cysteine methyl ester
CAS:Formula:C8H13NO4SPurity:96%Color and Shape:SolidMolecular weight:219.2581


