CAS 1955-21-1
:2,6-Diiodo-1,4-benzenediol
Description:
2,6-Diiodo-1,4-benzenediol, with the CAS number 1955-21-1, is an organic compound characterized by the presence of two iodine atoms and two hydroxyl (–OH) groups attached to a benzene ring. This compound features a diiodo substitution pattern at the 2 and 6 positions of the aromatic ring, while the hydroxyl groups are located at the 1 and 4 positions, making it a member of the dihydroxybenzene family. The presence of iodine atoms imparts significant reactivity and potential applications in various fields, including medicinal chemistry and materials science. The hydroxyl groups contribute to its solubility in polar solvents and enhance its ability to participate in hydrogen bonding. Additionally, the compound may exhibit interesting electronic properties due to the electron-withdrawing nature of the iodine substituents. Overall, 2,6-Diiodo-1,4-benzenediol is a versatile compound with potential applications in synthesis and research, particularly in the development of iodine-containing pharmaceuticals or as a precursor in organic synthesis.
Formula:C6H4I2O2
InChI:InChI=1S/C6H4I2O2/c7-4-1-3(9)2-5(8)6(4)10/h1-2,9-10H
InChI key:InChIKey=TXLWEPPRCDCHRB-UHFFFAOYSA-N
SMILES:OC1=C(I)C=C(O)C=C1I
Synonyms:- 1,4-Benzenediol, 2,6-diiodo-
- 2,6-Diiodo-1,4-benzenediol
- 2,6-Diiodobenzene-1,4-Diol
- 2,6-Diiodoquinol
- Brn 2209260
- Hydroquinone, 2,6-diiodo-
- 2,6-Diiodohydroquinone
- 3-06-00-04441 (Beilstein Handbook Reference)
- 2,6-Diiodohydroquinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
2,6-Diiodobenzene-1,4-diol
CAS:Controlled ProductApplications 2,6-Diiodobenzene-1,4-diol is a metabolite of the antithyroid compound, Diacetyl-2,6-diiodoohydroquinone.
References Serif, George S., et al.: Biochem. Pharma., 12(8), 885-91 (1963)Formula:C6H4I2O2Color and Shape:NeatMolecular weight:361.904


