CAS 19553-76-5: disialoganglioside G(D1B) from bovine brain
Description:Disialoganglioside G (D1B) is a complex glycosphingolipid predominantly found in the bovine brain, characterized by its unique structure that includes two sialic acid residues. This ganglioside plays a crucial role in cell-cell recognition, signaling, and membrane stability within the nervous system. Its structure consists of a ceramide backbone linked to a carbohydrate chain, which includes the sialic acid moieties that contribute to its negative charge and influence its interactions with other biomolecules. D1B is involved in various biological processes, including neuronal development and synaptic plasticity, and has been studied for its potential implications in neurodegenerative diseases. The presence of disialogangliosides like D1B is significant in the context of brain function and pathology, as they are implicated in modulating receptor activity and protecting neurons from oxidative stress. Overall, D1B exemplifies the intricate role of gangliosides in neurobiology and their potential as therapeutic targets in neurological disorders.
Formula:C80H144N4O37
InChI:InChI=1/C80H144N4O37/c1-4-6-8-10-12-14-16-18-19-21-23-25-27-29-31-33-54(96)83-36-49(44(91)32-30-28-26-24-22-20-17-15-13-11-9-7-5-2)111-74-65(104)63(102)67(52(40-88)114-74)116-76-66(105)72(68(53(41-89)115-76)117-73-57(84-43(3)90)71(61(100)51(39-87)112-73)118-75-64(103)62(101)60(99)50(38-86)113-75)121-80(78(108)109)35-46(93)56(82)70(120-80)59(98)48(95)42-110-79(77(106)107)34-45(92)55(81)69(119-79)58(97)47(94)37-85/h30,32,44-53,55-76,85-89,91-95,97-105H,4-29,31,33-42,81-82H2,1-3H3,(H,83,96)(H,84,90)(H,106,107)(H,108,109)/b32-30+/t44?,45-,46+,47?,48?,49?,50+,51+,52-,53+,55+,56-,57+,58?,59?,60-,61-,62-,63-,64+,65-,66+,67-,68-,69+,70-,71+,72+,73-,74-,75-,76-,79-,80-/m1/s1
- Synonyms:
- (2R,4S,5R,6R)-2-[(2R,3S,4S,5R,6S)-5-[(2R,3S,4S,5S,6S)-3-acetamido-5-hydroxy-6-(hydroxymethyl)-4-[(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-tetrahydropyran-2-yl]oxy-2-[(2R,3S,4R,5R,6R)-4,5-dihydroxy-2-(hydroxymethyl)-6-[(E)-2-hydroxy-1-[(octadecanoylamino)methyl]heptadec-3-enoxy]tetrahydropyran-3-yl]oxy-3-hydroxy-6-(hydroxymethyl)tetrahydropyran-4-yl]oxy-5-amino-6-[3-[(2R,4R,5S,6S)-5-amino-2-carboxy-4-hydroxy-6-(1,2,3-trihydroxypropyl)tetrahydropyran-2-yl]oxy-1,2-dihydroxy-propyl]-4-hydroxy-tetrahydropyran-2-carboxylic acid
- G<sub>D1b</sub>
- GD1b ganglioside
- Ganglioside C<sub>1</sub>
- Ganglioside G<sub>2</sub>
- Ganglioside G<sub>2</sub> (hexasaccharide)
- Ganglioside G<sub>D1b</sub>
- Ganglioside G<sub>III</sub>
- Ganglioside GD1b, Disialo, Diammonium Salt, Bovine Brain