CAS 195533-53-0
:2,3,4,5,6-pentafluoro-N-(3-fluoro-4-methoxyphenyl)benzenesulfonamide
Description:
2,3,4,5,6-Pentafluoro-N-(3-fluoro-4-methoxyphenyl)benzenesulfonamide is a synthetic organic compound characterized by its complex fluorinated structure. It features a sulfonamide functional group, which is known for its applications in pharmaceuticals and agrochemicals. The presence of multiple fluorine atoms contributes to its lipophilicity and stability, enhancing its potential as a bioactive molecule. The methoxy group on the phenyl ring may influence its electronic properties and solubility, while the fluorinated substituents can improve metabolic stability and alter its interaction with biological targets. This compound is likely to exhibit unique chemical reactivity and may be of interest in medicinal chemistry for developing new therapeutic agents. Its specific properties, such as melting point, solubility, and reactivity, would depend on the overall molecular structure and the arrangement of its substituents. As with many fluorinated compounds, it may also exhibit distinct environmental behavior and toxicity profiles, necessitating careful handling and assessment in research and application contexts.
Formula:C13H7F6NO3S
InChI:InChI=1/C13H7F6NO3S/c1-23-7-3-2-5(4-6(7)14)20-24(21,22)13-11(18)9(16)8(15)10(17)12(13)19/h2-4,20H,1H3
SMILES:COc1ccc(cc1F)NS(=O)(=O)c1c(c(c(c(c1F)F)F)F)F
Synonyms:- benzenesulfonamide, 2,3,4,5,6-pentafluoro-N-(3-fluoro-4-methoxyphenyl)-
- N-(3-Fluoro-4-methoxyphenyl)-2,3,4,5,6-pentafluorobenzenesulfonamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Batabulin
CAS:Batabulin (T138067), an antitumor agent, binds selectively to β-tubulin, halts microtubule formation, and induces apoptosis.Formula:C13H7F6NO3SPurity:99.85%Color and Shape:SolidMolecular weight:371.26Ref: TM-T10460
1mg48.00€5mg113.00€1mL*10mM (DMSO)124.00€10mg166.00€25mg281.00€50mg416.00€100mg602.00€500mg1,243.00€Batabulin
CAS:Batabulin is a peptide that is used as a research tool for ion channels and receptor interactions. It has been shown to inhibit the activation of potassium channels by binding to the Kv1.3 channel protein, which results in the inhibition of sodium currents. Batabulin has also been shown to inhibit the interaction between receptors and ligands, such as acetylcholine, histamine, and serotonin. Batabulin is an inhibitor of protein interactions and can be used in pharmacology studies.
Formula:C13H7F6NO3SPurity:Min. 95%Molecular weight:371.26 g/mol


