CAS 1955474-36-8

3-[(2S,4R)-4-Methoxy-2-pyrrolidinyl]-1,2,4-triazolo[4,3-a]pyrazine

Description:

3-[(2S,4R)-4-Methoxy-2-pyrrolidinyl]-1,2,4-triazolo[4,3-a]pyrazine is a chemical compound characterized by its complex structure, which includes a triazole and pyrazine moiety. The presence of the pyrrolidine ring, specifically in the (2S,4R) configuration, contributes to its stereochemical properties, influencing its biological activity and interactions. This compound is likely to exhibit specific pharmacological effects due to its unique arrangement of functional groups, which may interact with biological targets such as receptors or enzymes. The methoxy group enhances its lipophilicity, potentially affecting its solubility and permeability. Additionally, the triazole and pyrazine rings may contribute to its stability and reactivity. As a relatively novel compound, it may be of interest in medicinal chemistry for the development of therapeutic agents. However, detailed studies on its biological activity, toxicity, and pharmacokinetics would be necessary to fully understand its potential applications.

Formula: C₁₀H₁₃N₅O

InChI: InChI=1S/C10H13N5O/c1-16-7-4-8(12-5-7)10-14-13-9-6-11-2-3-15(9)10/h2-3,6-8,12H,4-5H2,1H3/t7-,8+/m1/s1

InChI key: InChIKey=IXJWFCJPPOYTSV-SFYZADRCSA-N

SMILES: O(C)[C@@H]1C[C@@H](C=2N3C(=NN2)C=NC=C3)NC1

Synonyms:

• 3-[(2S,4R)-4-Methoxy-2-pyrrolidinyl]-1,2,4-triazolo[4,3-a]pyrazine
• 1,2,4-Triazolo[4,3-a]pyrazine, 3-[(2S,4R)-4-methoxy-2-pyrrolidinyl]-

4-Methoxy-2-{[1,2,4]triazolo[4,3-a]pyrazin-3-yl}pyrrolidine

CAS: 1955474-36-8

Versatile small molecule scaffold

Formula: C₁₀H₁₃N₅O

Purity: Min. 95%

Molecular weight: 219.24 g/mol

Ref: 3D-FDD47436