CAS 1955514-49-4

Pyrrolidine, 3-[(4-iodophenyl)methyl]-, hydrochloride (1:1)

Description:

Pyrrolidine, 3-[(4-iodophenyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered saturated heterocyclic amine. The presence of a 4-iodobenzyl group at the 3-position of the pyrrolidine ring contributes to its unique properties, including potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The compound may exhibit properties such as being a potential ligand or intermediate in organic synthesis. Its molecular structure suggests it could interact with biological systems, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with many halogenated compounds, due to potential toxicity and environmental concerns. Overall, this compound represents a specific class of organic molecules that may have implications in drug development and research.

Formula: C₁₁H₁₄IN·ClH

InChI: InChI=1S/C11H14IN.ClH/c12-11-3-1-9(2-4-11)7-10-5-6-13-8-10;/h1-4,10,13H,5-8H2;1H

InChI key: InChIKey=ILHGXTWOTXFNRC-UHFFFAOYSA-N

SMILES: C(C1=CC=C(I)C=C1)C2CCNC2.Cl

Synonyms:

• Pyrrolidine, 3-[(4-iodophenyl)methyl]-, hydrochloride (1:1)

3-[(4-Iodophenyl)methyl]pyrrolidine hydrochloride

CAS: 1955514-49-4

Versatile small molecule scaffold

Formula: C₁₁H₁₅ClIN

Purity: Min. 95%

Molecular weight: 323.6 g/mol

Ref: 3D-FDD51449