CAS 1955519-77-3

4-Pyridineethanimidamide, hydrochloride (1:3)

Description:

4-Pyridineethanimidamide, hydrochloride (1:3) is a chemical compound characterized by its pyridine and ethanimidamide functional groups. It typically appears as a white to off-white crystalline solid, soluble in water and polar organic solvents due to the presence of the hydrochloride salt, which enhances its solubility. The compound is often studied for its potential biological activities, including antimicrobial and antitumor properties, owing to the reactivity of the imidamide group. Its molecular structure allows for hydrogen bonding, which can influence its interaction with biological targets. The compound's stability and reactivity can be affected by pH and temperature, making it important to handle it under controlled conditions. As with many chemical substances, safety precautions should be observed, including the use of personal protective equipment, as it may pose health risks if ingested or inhaled. Overall, 4-Pyridineethanimidamide, hydrochloride is of interest in medicinal chemistry and pharmacology for its potential therapeutic applications.

Formula: C₇H₉N₃·3ClH

InChI: InChI=1S/C7H9N3.3ClH/c8-7(9)5-6-1-3-10-4-2-6;;;/h1-4H,5H2,(H3,8,9);3*1H

InChI key: InChIKey=BQXONIVHQBTIJW-UHFFFAOYSA-N

SMILES: C(C(=N)N)C=1C=CN=CC1.Cl

Synonyms:

• 4-Pyridineethanimidamide, hydrochloride (1:3)

2-(Pyridin-4-yl)ethanimidamide trihydrochloride

CAS: 1955519-77-3

Versatile small molecule scaffold

Formula: C₇H₁₂Cl₃N₃

Purity: Min. 95%

Molecular weight: 244.5 g/mol

Ref: 3D-FDD51977