CAS 1955524-53-4

Acetamide, N-[(2,6-dimethoxyphenyl)methyl]-

Description:

Acetamide, N-[(2,6-dimethoxyphenyl)methyl]- is an organic compound characterized by its amide functional group, which is derived from acetic acid. This compound features a dimethoxy-substituted phenyl group, indicating the presence of two methoxy (-OCH3) groups attached to the aromatic ring at the 2 and 6 positions. The molecular structure suggests that it may exhibit both polar and nonpolar characteristics due to the presence of the aromatic ring and the amide group, which can engage in hydrogen bonding. This compound is likely to be soluble in polar solvents, such as alcohols and water, while also showing some solubility in organic solvents. Its potential applications may include use in pharmaceuticals or as an intermediate in organic synthesis, given the reactivity of the amide group. Additionally, the presence of methoxy groups can influence the compound's electronic properties and reactivity, potentially affecting its biological activity. As with any chemical substance, safety data and handling precautions should be consulted before use.

Formula: C₁₁H₁₅NO₃

InChI: InChI=1S/C11H15NO3/c1-8(13)12-7-9-10(14-2)5-4-6-11(9)15-3/h4-6H,7H2,1-3H3,(H,12,13)

InChI key: InChIKey=KOFRPILEEFGDBE-UHFFFAOYSA-N

SMILES: C(NC(C)=O)C1=C(OC)C=CC=C1OC

Synonyms:

• Acetamide, N-[(2,6-dimethoxyphenyl)methyl]-
• N-[(2,6-Dimethoxyphenyl)methyl]acetamide

N-[(2,6-Dimethoxyphenyl)methyl]acetamide

CAS: 1955524-53-4

Versatile small molecule scaffold

Formula: C₁₁H₁₅NO₃

Purity: Min. 95%

Molecular weight: 209.24 g/mol

Ref: 3D-FDD52453