CAS 1955531-78-8

Benzonitrile, 3-(3-pyrrolidinylamino)-, hydrochloride (1:1)

Description:

Benzonitrile, 3-(3-pyrrolidinylamino)-, hydrochloride (1:1) is a chemical compound characterized by its structural features, which include a benzonitrile moiety and a pyrrolidinylamino group. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols due to the presence of the hydrochloride salt form. The presence of the pyrrolidinylamino group suggests potential biological activity, as pyrrolidine derivatives are often explored for their pharmacological properties. The hydrochloride form enhances the stability and solubility of the compound, making it suitable for various applications in medicinal chemistry and drug development. As with many organic compounds, it is essential to handle this substance with care, following appropriate safety protocols, as it may exhibit toxicity or irritant properties. Its specific applications and effects would depend on further research and characterization, particularly in the context of its interaction with biological systems.

Formula: C₁₁H₁₃N₃·ClH

InChI: InChI=1S/C11H13N3.ClH/c12-7-9-2-1-3-10(6-9)14-11-4-5-13-8-11;/h1-3,6,11,13-14H,4-5,8H2;1H

InChI key: InChIKey=RDWLFTMPBXNVHQ-UHFFFAOYSA-N

SMILES: N(C1=CC(C#N)=CC=C1)C2CCNC2.Cl

Synonyms:

• Benzonitrile, 3-(3-pyrrolidinylamino)-, hydrochloride (1:1)

3-[(Pyrrolidin-3-yl)amino]benzonitrile hydrochloride

CAS: 1955531-78-8

Versatile small molecule scaffold

Formula: C₁₁H₁₄ClN₃

Purity: Min. 95%

Molecular weight: 223.7 g/mol

Ref: 3D-FDD53178