CAS 1955555-02-8

Cyclohexaneethanol, β-amino-3-methoxy-, hydrochloride (1:1)

Description:

Cyclohexaneethanol, β-amino-3-methoxy-, hydrochloride (1:1) is a chemical compound characterized by its structural features that include a cyclohexane ring, an ethanol moiety, and an amino group with a methoxy substituent. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and may influence its biological activity. The presence of the β-amino group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as amino alcohols often exhibit interesting biological properties. The methoxy group can also modify the compound's lipophilicity and reactivity. In terms of physical properties, compounds of this nature may exhibit moderate to high boiling points and varying degrees of polarity, depending on the specific functional groups present. Safety data and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Overall, the unique combination of functional groups in this compound may lead to diverse applications in research and industry.

Formula: C₉H₁₉NO₂·ClH

InChI: InChI=1S/C9H19NO2.ClH/c1-12-8-4-2-3-7(5-8)9(10)6-11;/h7-9,11H,2-6,10H2,1H3;1H

InChI key: InChIKey=AAUQPVXBNINILI-UHFFFAOYSA-N

SMILES: C(CO)(N)C1CC(OC)CCC1.Cl

Synonyms:

• Cyclohexaneethanol, β-amino-3-methoxy-, hydrochloride (1:1)

2-Amino-2-(3-methoxycyclohexyl)ethan-1-ol hydrochloride

CAS: 1955555-02-8

Versatile small molecule scaffold

Formula: C₉H₂₀ClNO₂

Purity: Min. 95%

Molecular weight: 209.71 g/mol

Ref: 3D-FDD55502