CAS 1955556-89-4

2H-Pyran-3-acetic acid, 3-aminotetrahydro-, hydrochloride (1:1)

Description:

2H-Pyran-3-acetic acid, 3-aminotetrahydro-, hydrochloride (1:1) is a chemical compound characterized by its pyran ring structure, which is a six-membered heterocyclic compound containing one oxygen atom. This substance features an acetic acid functional group and an amino group, contributing to its potential biological activity. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, which often enhances its solubility in water and stability. The presence of the amino group suggests that it may participate in various chemical reactions, including those typical of amines, such as nucleophilic substitutions. This compound may be of interest in medicinal chemistry and pharmacology due to its structural features, which could influence its interaction with biological targets. Additionally, the specific stereochemistry and functional groups present in the molecule can affect its reactivity and biological properties, making it a candidate for further research in drug development or as a biochemical tool.

Formula: C₇H₁₃NO₃·ClH

InChI: InChI=1S/C7H13NO3.ClH/c8-7(4-6(9)10)2-1-3-11-5-7;/h1-5,8H2,(H,9,10);1H

InChI key: InChIKey=ZCTXRSMGFUCGMN-UHFFFAOYSA-N

SMILES: C(C(O)=O)C1(N)CCCOC1.Cl

Synonyms:

• 2H-Pyran-3-acetic acid, 3-aminotetrahydro-, hydrochloride (1:1)

2-(3-Aminooxan-3-yl)acetic acid hydrochloride

CAS: 1955556-89-4

Versatile small molecule scaffold

Formula: C₇H₁₄ClNO₃

Purity: Min. 95%

Molecular weight: 195.64 g/mol

Ref: 3D-FDD55689