CAS 1956-42-9
:(4-Methylphenyl)-2-thienylmethanone oxime
Description:
(4-Methylphenyl)-2-thienylmethanone oxime, with the CAS number 1956-42-9, is an organic compound characterized by its oxime functional group, which is derived from the reaction of a ketone with hydroxylamine. This compound features a thienyl group, indicating the presence of a thiophene ring, which contributes to its aromatic properties and potential reactivity. The presence of the 4-methylphenyl group enhances its hydrophobic characteristics and may influence its solubility in organic solvents. Typically, compounds like this can exhibit biological activity, making them of interest in pharmaceutical and agrochemical research. The oxime functional group can participate in various chemical reactions, including rearrangements and condensation reactions, which may be relevant in synthetic organic chemistry. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the substituents on the aromatic rings. Overall, (4-Methylphenyl)-2-thienylmethanone oxime represents a versatile structure with potential applications in various chemical fields.
Formula:C12H11NOS
InChI:InChI=1S/C12H11NOS/c1-9-4-6-10(7-5-9)12(13-14)11-3-2-8-15-11/h2-8,14H,1H3
InChI key:InChIKey=RNIHSJJEPWOUKG-UHFFFAOYSA-N
SMILES:C(=NO)(C1=CC=C(C)C=C1)C2=CC=CS2
Synonyms:- Ketone, 2-thienyl p-tolyl, oxime
- (4-Methylphenyl)-2-thienylmethanone oxime
- Methanone, (4-methylphenyl)-2-thienyl-, oxime
- [2]Thienyl-p-tolyl ketone oxime
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.