CAS 195602-17-6

2,3-DIHYDRO-5-(2,3-DIHYDROTHIENO[3,4-B][1,4]DIOXIN-5-YL)THIENO[3,4-B][1,4]DIOXINE

Description:

2,3-Dihydro-5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)thieno[3,4-b][1,4]dioxine is a complex organic compound characterized by its unique bicyclic structure that incorporates both thieno and dioxin moieties. This compound features multiple fused rings, which contribute to its stability and potential reactivity. The presence of sulfur atoms in the thieno rings and the dioxin structure suggests that it may exhibit interesting electronic properties and biological activity. Typically, compounds of this nature can be investigated for their potential applications in pharmaceuticals, materials science, or as intermediates in organic synthesis. The specific arrangement of atoms and functional groups can influence its solubility, melting point, and reactivity with other chemical species. As with many organic compounds, the synthesis and characterization of this substance would require careful consideration of reaction conditions and purification methods to ensure the desired product is obtained. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.

Formula: C₁₂H₁₀O₄S₂

InChI: InChI=1/C12H10O4S2/c1-3-15-9-7(13-1)5-17-11(9)12-10-8(6-18-12)14-2-4-16-10/h5-6H,1-4H2

SMILES: C1COc2c(csc2c2c3c(cs2)OCCO3)O1

Synonyms:

• 2,3-Dihydro-5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)thieno[3,4-b]dioxine
• 2,2',3,3'-Tetrahydro-5,5'-Bithieno[3,4-B][1,4]Dioxine

BIS-EDOT

CAS: 195602-17-6

Formula: C₁₂H₁₀O₄S₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 282.3354

Ref: IN-DA007482

2,2',3,3'-Tetrahydro-5,5'-bithieno[3,4-b][1,4]dioxine

CAS: 195602-17-6

2,2',3,3'-Tetrahydro-5,5'-bithieno[3,4-b][1,4]dioxine

Purity: 95%

Molecular weight: 282.34g/mol

Ref: 54-OR1072558

2,2’-bis(3,4-ethylenedioxythiophene)

CAS: 195602-17-6

Ref: 7W-GX5955

2,2′,3,3′-Tetrahydro-5,5′-bithieno[3,4-b][1,4]dioxine

CAS: 195602-17-6

Formula: C₁₂H₁₀O₄S₂

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 282.33

Ref: 10-F324407

2,2',3,3'-Tetrahydro-5,5'-Bithieno[3,4-B][1,4]Dioxine

Controlled Product

CAS: 195602-17-6

Applications 2,2',3,3'-Tetrahydro-5,5'-Bithieno[3,4-B][1,4]Dioxine (cas# 195602-17-6) is a useful research chemical.

Formula: C₁₂H₁₀O₄S₂

Color and Shape: Neat

Molecular weight: 282.33

Ref: TR-T890480