CAS 195604-39-8: (S)-1-Cyclopropylethylamine

Description:(S)-1-Cyclopropylethylamine is an organic compound characterized by its cyclopropyl and ethylamine functional groups. It is a chiral amine, meaning it exists in two enantiomeric forms, with the (S)-configuration being one of them. This compound typically exhibits a colorless to pale yellow liquid state at room temperature and has a distinctive amine odor. Its molecular structure includes a cyclopropyl ring attached to an ethylamine chain, which contributes to its unique chemical properties. (S)-1-Cyclopropylethylamine is soluble in polar solvents like water and alcohols, making it useful in various chemical reactions and applications, particularly in the synthesis of pharmaceuticals and agrochemicals. The presence of the cyclopropyl group can influence the compound's reactivity and biological activity, making it of interest in medicinal chemistry. Additionally, due to its amine functionality, it can participate in hydrogen bonding, affecting its physical properties and interactions with other molecules. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula:C₅H₁₁N

InChI:InChI=1/C5H11N/c1-4(6)5-2-3-5/h4-5H,2-3,6H2,1H3/t4-/m0/s1

Synonyms:
(1S)-1-cyclopropylethanamine
(S)-1-(Cyclopropylethyl)amine

Found 4 products.

Product data	Purity	Price range	Estimated delivery
(S)-1-Cyclopropylethylamine, ChiPros™, 98%, ee 98+% REF: 02-H27499CAS: 195604-39-8	98+%	82.00 €~226.00 €	Thu 20 Mar 25
(S)-1-Cyclopropylethanamine REF: IN-DA003CJVCAS: 195604-39-8	97%	31.00 €~581.00 €	Wed 26 Mar 25
(S)-1-Cyclopropylethanamine REF: 10-F448438CAS: 195604-39-8	95.0%	To inquire	Mon 07 Apr 25
(S)-1-Cyclopropylethylamine REF: 3D-VHA60439CAS: 195604-39-8	Min. 95%	- - -	Discontinued product