CAS 19561-95-6
:1-[4-(2-chloroethoxy)phenyl]-2-phenylethanone
Description:
1-[4-(2-chloroethoxy)phenyl]-2-phenylethanone, with the CAS number 19561-95-6, is an organic compound characterized by its structure, which includes a phenyl group, an ethanone moiety, and a chloroethoxy substituent. This compound typically appears as a solid or crystalline substance and is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The presence of the chloroethoxy group suggests that it may exhibit specific reactivity patterns, particularly in nucleophilic substitution reactions. Additionally, the compound's phenyl groups contribute to its aromatic character, which can influence its solubility and stability in different solvents. Its chemical properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Overall, this compound is of interest in the field of synthetic organic chemistry due to its functional groups and potential utility in various chemical reactions.
Formula:C16H15ClO2
InChI:InChI=1/C16H15ClO2/c17-10-11-19-15-8-6-14(7-9-15)16(18)12-13-4-2-1-3-5-13/h1-9H,10-12H2
SMILES:c1ccc(cc1)CC(=O)c1ccc(cc1)OCCCl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-[4-(2-Chloroethoxy)phenyl]-2-phenylethanone
CAS:Controlled ProductApplications 1-[4-(2-Chloroethoxy)phenyl]-2-phenylethanone (cas# 19561-95-6) is a compound useful in organic synthesis.
Formula:C16H15ClO2Color and Shape:NeatMolecular weight:274.74
