CAS 1956306-23-2

Benzeneacetic acid, α-[methyl(phenylmethyl)amino]-, hydrochloride (1:1)

Description:

Benzeneacetic acid, α-[methyl(phenylmethyl)amino]-, hydrochloride (1:1) is a chemical compound characterized by its structure, which includes a benzene ring, an acetic acid moiety, and a methyl(phenylmethyl)amino group. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to its free base. The presence of the amino group suggests potential basic properties, while the carboxylic acid group contributes to its acidic characteristics. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular interactions can be influenced by the functional groups present, allowing for various applications in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, this compound represents a unique combination of functional groups that may contribute to its reactivity and potential applications in various fields.

Formula: C₁₆H₁₇NO₂·ClH

InChI: InChI=1S/C16H17NO2.ClH/c1-17(12-13-8-4-2-5-9-13)15(16(18)19)14-10-6-3-7-11-14;/h2-11,15H,12H2,1H3,(H,18,19);1H

InChI key: InChIKey=ZNRWZVPRUUDDBU-UHFFFAOYSA-N

SMILES: C(N(CC1=CC=CC=C1)C)(C(O)=O)C2=CC=CC=C2.Cl

Synonyms:

• Benzeneacetic acid, α-[methyl(phenylmethyl)amino]-, hydrochloride (1:1)

2-(benzyl(methyl)amino)-2-phenylacetic acid hydrochloride

CAS: 1956306-23-2

Formula: C₁₆H₁₈ClNO₂

Purity: 95%

Molecular weight: 291.7726

Ref: IN-DA01DJ66

2-[BENZYL(METHYL)AMINO]-2-PHENYLACETIC ACID HCL

CAS: 1956306-23-2

Formula: C₁₆H₁₈ClNO₂

Purity: 95.0%

Molecular weight: 291.78

Ref: 10-F505549