CymitQuimica logo

CAS 1956319-02-0

:

2-Acetyl-N,N-dimethyl-6-(phenylmethyl)-2,6-diazaspiro[3.4]octane-8-carboxamide

Description:
2-Acetyl-N,N-dimethyl-6-(phenylmethyl)-2,6-diazaspiro[3.4]octane-8-carboxamide is a complex organic compound characterized by its spirocyclic structure, which features a combination of nitrogen atoms and a carboxamide functional group. This compound is notable for its potential biological activity, often explored in medicinal chemistry for its pharmacological properties. The presence of the acetyl and dimethyl groups contributes to its lipophilicity, which can influence its interaction with biological membranes and receptors. The phenylmethyl substituent enhances its structural diversity, potentially affecting its binding affinity and selectivity in biological systems. As a spiro compound, it exhibits unique stereochemical properties that can impact its reactivity and interactions. The compound's CAS number, 1956319-02-0, allows for precise identification in chemical databases, facilitating research and development in various applications, including drug discovery and development. Overall, this compound represents a fascinating area of study due to its intricate structure and potential therapeutic implications.
Formula:C18H25N3O2
InChI:InChI=1S/C18H25N3O2/c1-14(22)21-12-18(13-21)11-20(9-15-7-5-4-6-8-15)10-16(18)17(23)19(2)3/h4-8,16H,9-13H2,1-3H3
InChI key:InChIKey=YSPAJHIZZKSCIB-UHFFFAOYSA-N
SMILES:C(N(C)C)(=O)C1C2(CN(CC3=CC=CC=C3)C1)CN(C(C)=O)C2
Synonyms:
  • 2-Acetyl-N,N-dimethyl-6-(phenylmethyl)-2,6-diazaspiro[3.4]octane-8-carboxamide
  • 2,6-Diazaspiro[3.4]octane-8-carboxamide, 2-acetyl-N,N-dimethyl-6-(phenylmethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.