CymitQuimica logo

CAS 1956319-09-7

:

Ethyl 6-bromo-1H-pyrrolo[3,2-c]pyridine-3-carboxylate

Description:
Ethyl 6-bromo-1H-pyrrolo[3,2-c]pyridine-3-carboxylate is a chemical compound characterized by its unique pyrrolopyridine structure, which features a bromine substituent at the 6-position and an ethyl ester functional group at the carboxylate position. This compound typically exhibits a molecular formula that reflects its complex structure, incorporating elements such as carbon, hydrogen, nitrogen, and bromine. The presence of the bromine atom contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. Ethyl 6-bromo-1H-pyrrolo[3,2-c]pyridine-3-carboxylate may display interesting biological activities, making it a candidate for further research in drug development. Its solubility characteristics can vary depending on the solvent, and it may be sensitive to light and moisture, necessitating careful handling and storage. Overall, this compound represents a valuable scaffold in the field of heterocyclic chemistry, with potential implications in various chemical and pharmaceutical applications.
Formula:C10H9BrN2O2
InChI:InChI=1S/C10H9BrN2O2/c1-2-15-10(14)7-5-12-8-3-9(11)13-4-6(7)8/h3-5,12H,2H2,1H3
InChI key:InChIKey=UXIMYPNZGSBXBV-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C=2C(NC1)=CC(Br)=NC2
Synonyms:
  • 1H-Pyrrolo[3,2-c]pyridine-3-carboxylic acid, 6-bromo-, ethyl ester
  • Ethyl 6-bromo-1H-pyrrolo[3,2-c]pyridine-3-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.