CAS 1956340-44-5

1H-Benzimidazol-2-amine, 1,4-dimethyl-, hydrochloride (1:1)

Description:

1H-Benzimidazol-2-amine, 1,4-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. This compound features two methyl groups at the 1 and 4 positions of the benzimidazole ring, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the amine group suggests potential basicity, allowing it to participate in various chemical reactions, including nucleophilic substitutions. This compound may exhibit biological activity, making it of interest in medicinal chemistry for the development of therapeutic agents. Its specific characteristics, such as melting point, solubility, and stability, can vary based on environmental conditions and the presence of other substances. As with many chemical compounds, safety data should be consulted to ensure proper handling and usage in laboratory or industrial settings.

Formula: C₉H₁₁N₃·ClH

InChI: InChI=1S/C9H11N3.ClH/c1-6-4-3-5-7-8(6)11-9(10)12(7)2;/h3-5H,1-2H3,(H2,10,11);1H

InChI key: InChIKey=MACFEUZQXADXHP-UHFFFAOYSA-N

SMILES: CN1C=2C(=C(C)C=CC2)N=C1N.Cl

Synonyms:

• 1H-Benzimidazol-2-amine, 1,4-dimethyl-, hydrochloride (1:1)