
CAS 1956354-85-0
:1,1-Dimethylethyl N-(3,3,3-trifluoro-2-hydroxy-1-phenylpropyl)carbamate
Description:
1,1-Dimethylethyl N-(3,3,3-trifluoro-2-hydroxy-1-phenylpropyl)carbamate, identified by its CAS number 1956354-85-0, is a chemical compound that belongs to the class of carbamates. This substance features a complex structure characterized by the presence of a tert-butyl group, which contributes to its steric bulk, and a trifluoromethyl group that enhances its lipophilicity and potential biological activity. The molecule also contains a hydroxy group, which can participate in hydrogen bonding, influencing its solubility and reactivity. The phenylpropyl moiety suggests potential interactions with biological targets, making it of interest in pharmaceutical applications. The trifluoromethyl group is known for imparting unique electronic properties, which can affect the compound's stability and reactivity. Overall, the characteristics of this compound suggest it may have specific applications in medicinal chemistry, particularly in the development of therapeutic agents. However, detailed studies on its biological activity, toxicity, and environmental impact would be necessary to fully understand its potential uses and safety profile.
Formula:C14H18F3NO3
InChI:InChI=1S/C14H18F3NO3/c1-13(2,3)21-12(20)18-10(11(19)14(15,16)17)9-7-5-4-6-8-9/h4-8,10-11,19H,1-3H3,(H,18,20)
InChI key:InChIKey=PZVPCYIOYOTOEP-UHFFFAOYSA-N
SMILES:C(C(C(F)(F)F)O)(NC(OC(C)(C)C)=O)C1=CC=CC=C1
Synonyms:- 1,1-Dimethylethyl N-(3,3,3-trifluoro-2-hydroxy-1-phenylpropyl)carbamate
- Carbamic acid, N-(3,3,3-trifluoro-2-hydroxy-1-phenylpropyl)-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.