CAS 1956355-01-3
:2-(Tetrahydro-4-phenyl-2H-pyran-4-yl)propanedinitrile
Description:
2-(Tetrahydro-4-phenyl-2H-pyran-4-yl)propanedinitrile is a chemical compound characterized by its unique structure, which includes a tetrahydro-2H-pyran ring fused with a phenyl group and a propanedinitrile moiety. This compound typically exhibits properties associated with both organic nitriles and cyclic compounds, such as moderate polarity and potential reactivity due to the presence of the nitrile functional groups. The tetrahydro-4-phenyl-2H-pyran structure contributes to its stability and may influence its solubility in various organic solvents. Additionally, the presence of multiple functional groups suggests potential applications in organic synthesis, pharmaceuticals, or as intermediates in chemical reactions. The compound's molecular interactions, including hydrogen bonding and dipole-dipole interactions, may also play a significant role in its behavior in different chemical environments. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C14H14N2O
InChI:InChI=1S/C14H14N2O/c15-10-13(11-16)14(6-8-17-9-7-14)12-4-2-1-3-5-12/h1-5,13H,6-9H2
InChI key:InChIKey=XHIZHAVPTPRQIK-UHFFFAOYSA-N
SMILES:C(C#N)(C#N)C1(CCOCC1)C2=CC=CC=C2
Synonyms:- 2-(Tetrahydro-4-phenyl-2H-pyran-4-yl)propanedinitrile
- Propanedinitrile, 2-(tetrahydro-4-phenyl-2H-pyran-4-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.