CAS 1956366-10-1: 1H-Pyrrole-2-carboxamide, 4-[5-chloro-2-[(1-methylethyl)amino]-4-pyridinyl]-N-[(1S)-1-(3-chlorophenyl)-2-hydroxyethyl]-, hydrochloride (1:1)
Description:1H-Pyrrole-2-carboxamide, 4-[5-chloro-2-[(1-methylethyl)amino]-4-pyridinyl]-N-[(1S)-1-(3-chlorophenyl)-2-hydroxyethyl]-, hydrochloride (1:1), identified by CAS number 1956366-10-1, is a synthetic organic compound characterized by its complex molecular structure, which includes a pyrrole ring and various functional groups such as amines and hydroxyls. This compound typically exhibits properties associated with its heterocyclic structure, including potential biological activity, making it of interest in pharmaceutical research. The presence of chlorine substituents may influence its reactivity and interaction with biological targets. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, enhancing its bioavailability. The compound's stereochemistry, indicated by the (1S) configuration, suggests specific spatial arrangements that can affect its pharmacological properties. Overall, this compound's unique characteristics make it a candidate for further investigation in medicinal chemistry and drug development.
Formula:C21H22Cl2N4O2·ClH
InChI:InChI=1S/C21H22Cl2N4O2.ClH/c1-12(2)26-20-8-16(17(23)10-25-20)14-7-18(24-9-14)21(29)27-19(11-28)13-4-3-5-15(22)6-13;/h3-10,12,19,24,28H,11H2,1-2H3,(H,25,26)(H,27,29);1H/t19-;/m1./s1
InChI key:InChIKey=DKGYQCPFBWFTHM-FSRHSHDFSA-N
SMILES:Cl.O=C(NC(C=1C=CC=C(Cl)C1)CO)C2=CC(=CN2)C=3C=C(N=CC3Cl)NC(C)C
- Synonyms:
- 1H-Pyrrole-2-carboxamide, 4-[5-chloro-2-[(1-methylethyl)amino]-4-pyridinyl]-N-[(1S)-1-(3-chlorophenyl)-2-hydroxyethyl]-, hydrochloride (1:1)
