CAS 1956371-16-6

Spiro[3H-indole-3,4′-piperidin]-2(1H)-one, 2,2,2-trifluoroacetate (1:1)

Description:

Spiro[3H-indole-3,4′-piperidin]-2(1H)-one, 2,2,2-trifluoroacetate (1:1) is a chemical compound characterized by its unique spirocyclic structure, which combines an indole moiety with a piperidine ring. This compound features a trifluoroacetate group, which enhances its solubility and reactivity due to the presence of highly electronegative fluorine atoms. The spiro configuration contributes to its potential biological activity, making it of interest in medicinal chemistry. The compound is likely to exhibit specific interactions with biological targets, potentially influencing its pharmacological properties. Its CAS number, 1956371-16-6, allows for precise identification in chemical databases. As with many compounds containing fluorinated groups, it may exhibit increased stability and lipophilicity, which can affect its absorption and distribution in biological systems. Overall, this compound represents a fascinating area of study for researchers interested in drug design and development, particularly in the context of novel therapeutic agents.

Formula: C₁₂H₁₄N₂O·C₂HF₃O₂

InChI: InChI=1S/C12H14N2O.C2HF3O2/c15-11-12(5-7-13-8-6-12)9-3-1-2-4-10(9)14-11;3-2(4,5)1(6)7/h1-4,13H,5-8H2,(H,14,15);(H,6,7)

InChI key: InChIKey=OQAGVXCHYOJYTB-UHFFFAOYSA-N

SMILES: O=C1C2(C=3C(N1)=CC=CC3)CCNCC2.C(C(O)=O)(F)(F)F

Synonyms:

• Spiro[3H-indole-3,4′-piperidin]-2(1H)-one, 2,2,2-trifluoroacetate (1:1)

1,2-Dihydrospiro[indole-3,4'-piperidine]-2-one; trifluoroacetic acid

CAS: 1956371-16-6

Purity: 97%

Molecular weight: 316.2799987792969

Ref: 10-F602758