CAS 1956379-16-0

2-(4-Bromophenyl)-7-chloro-2H-pyrazolo[3,4-d]pyridazine

Description:

2-(4-Bromophenyl)-7-chloro-2H-pyrazolo[3,4-d]pyridazine is a heterocyclic compound characterized by its complex structure, which includes a pyrazolo[3,4-d]pyridazine core. This compound features a bromophenyl substituent at the 2-position and a chlorine atom at the 7-position, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific solvent and conditions. The presence of halogen atoms (bromine and chlorine) can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound may exhibit biological activity, which is often explored in medicinal chemistry for potential therapeutic applications. Its molecular structure suggests that it could interact with biological targets, making it of interest in drug discovery and development. As with many heterocycles, the stability and reactivity of this compound can be influenced by the electronic effects of the substituents and the overall molecular conformation.

Formula: C₁₁H₆BrClN₄

InChI: InChI=1S/C11H6BrClN4/c12-8-1-3-9(4-2-8)17-6-7-5-14-15-11(13)10(7)16-17/h1-6H

InChI key: InChIKey=UYUJCOYIBWOLEC-UHFFFAOYSA-N

SMILES: ClC=1C2=NN(C=C2C=NN1)C3=CC=C(Br)C=C3

Synonyms:

• 2-(4-Bromophenyl)-7-chloro-2H-pyrazolo[3,4-d]pyridazine
• 2H-Pyrazolo[3,4-d]pyridazine, 2-(4-bromophenyl)-7-chloro-