CAS 1956381-56-8

1H-Imidazole-1-ethanimidamide, hydrochloride (1:1)

Description:

1H-Imidazole-1-ethanimidamide, hydrochloride (1:1) is a chemical compound characterized by its imidazole ring structure, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound typically appears as a white to off-white solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The imidazole moiety is known for its biological significance, often acting as a building block in various pharmaceuticals and biochemicals. The ethanimidamide group contributes to its potential as a bioactive molecule, possibly influencing its interaction with biological targets. The hydrochloride form indicates that the compound is protonated, which can affect its pharmacokinetic properties, such as absorption and distribution. As with many imidazole derivatives, this compound may exhibit properties such as antimicrobial or antifungal activity, making it of interest in medicinal chemistry. However, specific biological activities and applications would require further investigation and validation through experimental studies.

Formula: C₅H₈N₄·ClH

InChI: InChI=1S/C5H8N4.ClH/c6-5(7)3-9-2-1-8-4-9;/h1-2,4H,3H2,(H3,6,7);1H

InChI key: InChIKey=QAFKFZBVQNSREC-UHFFFAOYSA-N

SMILES: C(C(=N)N)N1C=CN=C1.Cl

Synonyms:

• 1H-Imidazole-1-ethanimidamide, hydrochloride (1:1)

2-(1H-Imidazol-1-yl)ethanimidamide hydrochloride

CAS: 1956381-56-8

Versatile small molecule scaffold

Formula: C₅H₉ClN₄

Purity: Min. 95%

Molecular weight: 160.6 g/mol

Ref: 3D-GDD38156