CAS 1956436-48-8: 2H-1-Benzopyran-4-amine, 6-chloro-3,4-dihydro-, hydrochloride (1:1), (4S)-
Description:2H-1-Benzopyran-4-amine, 6-chloro-3,4-dihydro-, hydrochloride (1:1), (4S)- is a chemical compound characterized by its benzopyran structure, which consists of a fused benzene and pyran ring. The presence of an amine group at the 4-position and a chlorine atom at the 6-position contributes to its unique reactivity and potential biological activity. The hydrochloride salt form indicates that the compound is protonated, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical contexts. The (4S)- designation refers to the specific stereochemistry of the compound, which can influence its interaction with biological targets. This compound may exhibit properties such as antioxidant activity, and its structural features suggest potential use in medicinal chemistry, particularly in the development of therapeutic agents. As with many organic compounds, its stability, reactivity, and biological effects can be influenced by environmental conditions and the presence of other chemical entities.
Formula:C9H10ClNO·ClH
InChI:InChI=1S/C9H10ClNO.ClH/c10-6-1-2-9-7(5-6)8(11)3-4-12-9;/h1-2,5,8H,3-4,11H2;1H/t8-;/m0./s1
InChI key:InChIKey=ARFUFGWFRJZAHS-QRPNPIFTSA-N
SMILES:Cl.ClC1=CC=C2OCCC(N)C2=C1
- Synonyms:
- 2H-1-Benzopyran-4-amine, 6-chloro-3,4-dihydro-, hydrochloride (1:1), (4S)-
(S)-6-Chlorochroman-4-amine hydrochloride
Ref: IN-DA00I3JR
| 1g | 633.00 € | ||
| 100mg | 142.00 € | ||
| 250mg | 166.00 € |
(4S)-6-Chlorochroman-4-amine hydrochloride
Ref: 54-OR958124
| 1g | 899.00 € | ||
| 250mg | 270.00 € |
Ref: 10-F512728
| 1g | 484.00 € | ||
| 5g | 2,223.00 € | ||
| 100mg | 91.00 € | ||
| 250mg | 156.00 € |
(4S)-6-Chlorochroman-4-amine hydrochloride
Ref: 3D-GDD43648
| 1g | Discontinued | Request information |
