CAS 1956436-49-9: 2H-1-Benzopyran-4-amine, 3,4-dihydro-7-methyl-, hydrochloride (1:1), (4S)-

Description:2H-1-Benzopyran-4-amine, 3,4-dihydro-7-methyl-, hydrochloride (1:1), (4S)- is a chemical compound characterized by its benzopyran structure, which consists of a fused benzene and pyran ring. This compound features an amine functional group, indicating it has basic properties and can participate in various chemical reactions, such as forming salts with acids, as evidenced by its hydrochloride form. The presence of a methyl group at the 7-position contributes to its unique chemical properties and potential biological activity. The (4S)- designation indicates the specific stereochemistry of the molecule, which can significantly influence its interactions in biological systems. This compound may be of interest in medicinal chemistry and pharmacology due to its structural features, which could relate to various therapeutic effects. As with many organic compounds, its solubility, stability, and reactivity will depend on environmental conditions such as pH and temperature. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula:C₁₀H₁₃NO·ClH

InChI:InChI=1S/C10H13NO.ClH/c1-7-2-3-8-9(11)4-5-12-10(8)6-7;/h2-3,6,9H,4-5,11H2,1H3;1H/t9-;/m0./s1

InChI key:InChIKey=MHKGPURQDGVONT-FVGYRXGTSA-N

SMILES:Cl.O1C2=CC(=CC=C2C(N)CC1)C

Synonyms:
2H-1-Benzopyran-4-amine, 3,4-dihydro-7-methyl-, hydrochloride (1:1), (4S)-

Found 4 products.

Product data	Purity	Price range	Estimated delivery
(S)-7-methylchroman-4-amine hydrochloride REF: IN-DA01FPRECAS: 1956436-49-9	95%	290.00 €~567.00 €	Wed 26 Mar 25
(S)-7-Methylchroman-4-amine hydrochloride REF: 54-OR88466CAS: 1956436-49-9	95%	446.00 €~1,913.00 €	Thu 27 Mar 25
(S)-7-Methylchroman-4-amine hydrochloride REF: 10-F693250CAS: 1956436-49-9	95%	241.00 €~825.00 €	Mon 31 Mar 25
(S)-7-Methylchroman-4-amine hydrochloride REF: 3D-GDD43649CAS: 1956436-49-9	Min. 95%	- - -	Discontinued product