
CAS 1956436-62-6
:1,1-Dimethylethyl N-[(2S)-3-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-2-fluoropropyl]carbamate
Description:
1,1-Dimethylethyl N-[(2S)-3-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-2-fluoropropyl]carbamate, identified by its CAS number 1956436-62-6, is a chemical compound characterized by its complex structure, which includes a carbamate functional group and a fluoropropyl moiety. This compound features a tert-butyl group, which contributes to its steric bulk, and a dimethylsilyl group that enhances its stability and solubility in organic solvents. The presence of a fluorine atom in the propyl chain can impart unique electronic properties, potentially affecting its reactivity and interaction with biological systems. The stereochemistry indicated by the (2S) designation suggests that the compound has a specific three-dimensional arrangement, which may influence its biological activity and pharmacokinetics. Overall, this compound's unique structural features make it of interest in various fields, including medicinal chemistry and materials science, where its properties can be leveraged for specific applications.
Formula:C14H30FNO3Si
InChI:InChI=1S/C14H30FNO3Si/c1-13(2,3)19-12(17)16-9-11(15)10-18-20(7,8)14(4,5)6/h11H,9-10H2,1-8H3,(H,16,17)/t11-/m0/s1
InChI key:InChIKey=HZVSSELOEOOSBY-NSHDSACASA-N
SMILES:[Si](C(C)(C)C)(OC[C@H](CNC(OC(C)(C)C)=O)F)(C)C
Synonyms:- 1,1-Dimethylethyl N-[(2S)-3-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-2-fluoropropyl]carbamate
- Carbamic acid, N-[(2S)-3-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-2-fluoropropyl]-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.