CAS 1958100-55-4

4-Isothiazolamine, 3-methyl-, hydrochloride (1:1)

Description:

4-Isothiazolamine, 3-methyl-, hydrochloride (1:1) is a chemical compound characterized by its isothiazole ring structure, which is a five-membered heterocyclic compound containing both sulfur and nitrogen atoms. This substance typically appears as a white to off-white crystalline solid and is soluble in water, which is a common trait for many hydrochloride salts. The presence of the isothiazole moiety suggests potential biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. Its hydrochloride form indicates that it is a salt formed with hydrochloric acid, which often enhances the stability and solubility of the compound. The compound may exhibit antimicrobial properties, as many isothiazole derivatives are known for their efficacy against a range of microorganisms. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.

Formula: C₄H₆N₂S·ClH

InChI: InChI=1S/C4H6N2S.ClH/c1-3-4(5)2-7-6-3;/h2H,5H2,1H3;1H

InChI key: InChIKey=GRQHKXUKSZPBEN-UHFFFAOYSA-N

SMILES: NC=1C(C)=NSC1.Cl

Synonyms:

• 3-Methylisothiazol-4-amine hydrochloride
• 4-Isothiazolamine, 3-methyl-, hydrochloride (1:1)

3-methyl-1,2-thiazol-4-amine hydrochloride

CAS: 1958100-55-4

Formula: C₄H₇ClN₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 150.6298

Ref: IN-DA01EI00

3-Methylisothiazol-4-amine hydrochloride

CAS: 1958100-55-4

3-Methylisothiazol-4-amine hydrochloride

Purity: 98%

Molecular weight: 150.63g/mol

Ref: 54-OR78068

3-METHYLISOTHIAZOL-4-AMINE HCL

CAS: 1958100-55-4

Formula: C₄H₇ClN₂S

Purity: 98%

Molecular weight: 150.62

Ref: 10-F542238