CAS 195827-82-8
:Methyl-2,3,4,6-tetra-O-benzyl-D-galactopyranoside
Description:
Methyl-2,3,4,6-tetra-O-benzyl-D-galactopyranoside is a glycoside derivative of galactose, characterized by the presence of four benzyl groups attached to the hydroxyl positions of the galactopyranose ring. This compound is typically used in organic synthesis and carbohydrate chemistry due to its ability to serve as a glycosyl donor or acceptor in glycosylation reactions. The presence of the benzyl groups enhances the lipophilicity of the molecule, which can facilitate its solubility in organic solvents while also providing steric hindrance that can influence reactivity. The methyl group at the anomeric position contributes to the stability of the glycosidic bond, making it less reactive compared to free sugars. Methyl-2,3,4,6-tetra-O-benzyl-D-galactopyranoside is often utilized in the synthesis of more complex carbohydrates and glycoproteins, and its structural features make it a valuable intermediate in the development of various biochemical applications. As with many glycosides, it may exhibit specific biological activities, although detailed studies would be necessary to elucidate these properties.
Formula:C35H38O6
InChI:InChI=1/C35H38O6/c1-36-35-34(40-25-30-20-12-5-13-21-30)33(39-24-29-18-10-4-11-19-29)32(38-23-28-16-8-3-9-17-28)31(41-35)26-37-22-27-14-6-2-7-15-27/h2-21,31-35H,22-26H2,1H3/t31-,32+,33+,34-,35-/m1/s1
Synonyms:- methyl 2,3,4,6-tetra-O-benzyl-alpha-D-galactopyranoside
- methyl 2,3,4,6-tetra-O-benzyl-beta-D-galactopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Methyl 2,3,4,6-tetra-o-benzyl-d-galactopyranoside
CAS:Formula:C35H38O6Purity:95%Color and Shape:LiquidMolecular weight:554.6726(2R,3S,4S,5R)-3,4,5-Tris(benzyloxy)-2-((benzyloxy)methyl)-6-methoxytetrahydro-2H-pyran
CAS:(2R,3S,4S,5R)-3,4,5-Tris(benzyloxy)-2-((benzyloxy)methyl)-6-methoxytetrahydro-2H-pyranPurity:95%Molecular weight:554.68g/molMethyl 2,3,4,6-tetra-O-benzyl-D-galactopyranoside
CAS:Methyl 2,3,4,6-tetra-O-benzyl-D-galactopyranoside is a trisaccharide that binds to the fluorescent chromophore. It has been shown to have strong binding activity and can be used for the labeling of carbohydrates. Methyl 2,3,4,6-tetra-O-benzyl-D-galactopyranoside is also used in assays to detect toxins or as a fluorescent label for polymers. This compound can be synthesized by reacting methyl 4,6-dibenzyloxybenzoate with glucose in methanol.
Formula:C35H38O6Purity:Min. 95%Color and Shape:PowderMolecular weight:554.67 g/mol



