CAS 195883-06-8
:YM 262
Description:
YM 262, with the CAS number 195883-06-8, is a chemical compound that belongs to a class of substances known for their potential pharmacological applications. It is characterized by its specific molecular structure, which includes various functional groups that contribute to its biological activity. YM 262 has been studied primarily for its role as a selective inhibitor of certain enzymes, which may have implications in therapeutic areas such as oncology or metabolic disorders. The compound exhibits moderate to high solubility in organic solvents, and its stability can vary depending on environmental conditions such as pH and temperature. Additionally, YM 262's interactions with biological systems are of significant interest, as they can influence its efficacy and safety profile. Research into YM 262 continues to explore its mechanism of action, potential side effects, and overall therapeutic potential, making it a subject of interest in medicinal chemistry and drug development.
Formula:C24H28O9
InChI:InChI=1S/C24H28O9/c1-10(2)22-17(32-22)18-24(33-18)21(3)7-6-11-12(9-29-19(11)28)13(21)8-14-23(24,31-14)20(22)30-16(27)5-4-15(25)26/h10,13-14,17-18,20H,4-9H2,1-3H3,(H,25,26)/t13-,14-,17-,18-,20+,21-,22-,23+,24+/m0/s1
InChI key:InChIKey=HROMYAWHLUOUPY-AHCCQAQQSA-N
SMILES:C[C@@]12[C@@]34[C@]5([C@H](OC(CCC(O)=O)=O)[C@]6([C@H](C)C)[C@]([C@@]3(O4)[H])(O6)[H])[C@@](O5)(C[C@]1(C7=C(CC2)C(=O)OC7)[H])[H]
Synonyms:- Butanedioic acid, 3-(3,4-dichlorophenyl)-2-(ethoxymethyl)-8-methyl-, 1-[(3bS,4aS,5aR,6R,6aS,7aS,7bS,8aS,8bS)-1,3,3b,4,4a,6,6a,7a,7b,8b,9,10-dodecahydro-8b-methyl-6a-(1-methylethyl)-1-oxotrisoxireno[4b,5:6,7:8a,9]phenanthro[1,2-c]furan-6-yl] ester
- Butanedioic acid, mono[(3bS,4aS,5aR,6R,6aS,7aS,7bS,8aS,8bS)-1,3,3b,4,4a,6,6a,7a,7b,8b,9,10-dodecahydro-8b-methyl-6a-(1-methylethyl)-1-oxotrisoxireno[4b,5:6,7:8a,9]phenanthro[1,2-c]furan-6-yl] ester
- Butanedioic acid, mono[1,3,3b,4,4a,6,6a,7a,7b,8b,9,10-dodecahydro-8b-methyl-6a-(1-methylethyl)-1-oxotrisoxireno[4b,5:6,7:8a,9]phenanthro[1,2-c]furan-6-yl] ester, [3bS-(3bα,4aα,5aS*,6β,6aβ,7aβ,7bα,8aR*,8bβ)]-
- Unii-D36Elm729P
- Ym 262
- Omtriptolide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Omtriptolide
CAS:<p>Omtriptolide is a synthetic derivative of triptolide, which is a diterpenoid epoxide originating from the plant Tripterygium wilfordii, also known as "Thunder God Vine." The compound is engineered to leverage the bioactive properties of triptolide while enhancing its stability and solubility for research and therapeutic purposes. Omtriptolide exerts its effects by inhibiting RNA polymerase II-mediated transcription, leading to the downregulation of anti-apoptotic proteins and thereby inducing apoptosis in cancer cells. It further disrupts the cellular stress response and modulates immune responses, inhibiting tumor growth.</p>Formula:C24H28O9Purity:Min. 95%Molecular weight:460.47 g/molOmtriptolide
CAS:<p>Omtriptolide, triptolide purified from the Chinese herb, is a water-soluble derivative prodrug.</p>Formula:C24H28O9Purity:98%Color and Shape:SolidMolecular weight:460.479

