CAS 195964-53-5
:tert-butyl 3-methoxymorpholine-4-carboxylate
Description:
Tert-butyl 3-methoxymorpholine-4-carboxylate is an organic compound characterized by its morpholine ring structure, which contributes to its unique chemical properties. This compound features a tert-butyl group, enhancing its lipophilicity and stability, while the methoxy group provides additional reactivity and solubility in organic solvents. The carboxylate functional group is crucial for its potential applications in organic synthesis and medicinal chemistry, as it can participate in various chemical reactions, including esterification and nucleophilic substitutions. The presence of the morpholine ring suggests potential biological activity, making it a candidate for pharmaceutical research. Additionally, the compound's molecular structure allows for various stereochemical configurations, which can influence its reactivity and interactions with biological targets. Overall, tert-butyl 3-methoxymorpholine-4-carboxylate is a versatile compound with significant implications in synthetic organic chemistry and drug development.
Formula:C10H19NO4
InChI:InChI=1/C10H19NO4/c1-10(2,3)15-9(12)11-5-6-14-7-8(11)13-4/h8H,5-7H2,1-4H3
SMILES:CC(C)(C)OC(=O)N1CCOCC1OC
Synonyms:- tert-Butyl 3-methoxymorpholine-4-carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-Methoxymorpholine, N-BOC protected
CAS:3-Methoxymorpholine, N-BOC protectedPurity:98%Color and Shape:SolidMolecular weight:217.26g/mol4-Boc-3-methoxy-morpholine
CAS:Formula:C10H19NO4Purity:98.0%Color and Shape:SolidMolecular weight:217.265tert-Butyl 3-methoxymorpholine-4-carboxylate
CAS:<p>Tert-butyl 3-methoxymorpholine-4-carboxylate is an isomeric morpholine. It was originally synthesized as a target compound for medicinal chemistry, and has been shown to have electrochemical activity. Tert-butyl 3-methoxymorpholine-4-carboxylate has also been used in the discovery of new drugs. This compound is an inhibitor of protein synthesis, which may be due to its ability to inhibit the enzymes involved in the process or its ability to bind tightly with ribosomes.</p>Formula:C10H19NO4Purity:Min. 95%Molecular weight:217.26 g/mol


