CymitQuimica logo

CAS 19598-45-9

:

(4aR,5S)-4a,5-dimethyl-3-propan-2-ylidene-5,6,7,8-tetrahydro-4H-naphthalen-2-one

Description:
The chemical substance known as (4aR,5S)-4a,5-dimethyl-3-propan-2-ylidene-5,6,7,8-tetrahydro-4H-naphthalen-2-one, with the CAS number 19598-45-9, is a complex organic compound characterized by its unique bicyclic structure. It features a naphthalene core that is partially saturated, indicating the presence of both aromatic and aliphatic characteristics. The specific stereochemistry, denoted by the (4aR,5S) configuration, suggests that the compound has distinct spatial arrangements that can influence its reactivity and interactions with biological systems. This compound may exhibit properties typical of ketones, such as being a potential electrophile in various chemical reactions. Additionally, the presence of multiple methyl groups and a propan-2-ylidene substituent contributes to its hydrophobic nature, which may affect its solubility in different solvents. Overall, this compound's structural features suggest potential applications in organic synthesis and medicinal chemistry, although specific biological activities would require further investigation.
Formula:C15H22O
InChI:InChI=1/C15H22O/c1-10(2)13-9-15(4)11(3)6-5-7-12(15)8-14(13)16/h8,11H,5-7,9H2,1-4H3/t11-,15+/m0/s1
Synonyms:
  • 9,10-Dehydrofukinone
  • Fukinone, 9,10-dehydro-
  • (4aR,5S)-4a,5-dimethyl-3-(propan-2-ylidene)-4,4a,5,6,7,8-hexahydronaphthalen-2(3H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.