CAS 196-78-1
:Benzo[g]chrysene
Description:
Benzo[g]chrysene is a polycyclic aromatic hydrocarbon (PAH) characterized by its complex fused ring structure, which consists of five fused benzene rings. It is a colorless to pale yellow solid at room temperature and is known for its high stability and low solubility in water. This compound is primarily found in fossil fuels and is produced during the incomplete combustion of organic materials, making it a common environmental contaminant. Benzo[g]chrysene is recognized for its potential carcinogenic properties, as it can form DNA adducts, leading to mutations and contributing to cancer development. Its presence in the environment is often monitored due to its toxicological significance, particularly in relation to air quality and food safety. Additionally, it is used in research to study the effects of PAHs on human health and the environment. Handling this substance requires caution due to its hazardous nature, and it is subject to regulatory guidelines to minimize exposure.
Formula:C22H14
InChI:InChI=1S/C22H14/c1-2-8-16-15(7-1)13-14-21-19-11-4-3-9-17(19)18-10-5-6-12-20(18)22(16)21/h1-14H
InChI key:InChIKey=JZOIZKBKSZMVRV-UHFFFAOYSA-N
SMILES:C12=C(C=3C(C=4C1=CC=CC4)=CC=CC3)C=CC=5C2=CC=CC5
Synonyms:- 1,2,3,4-Dibenzophenanthrene
- 1,2,3,4-Dibenzphenanthrene
- 1,2:3,4-Dibenzophenanthrene
- 1,2:3,4:7,8-Tribenznaphthalene
- Benzo[a]triphenylene
- Benzo[g]chrysene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

