CAS 19605-80-2
:6,10-Methanobenzocyclodecene-3,8,11,12-tetrol, 1,2,3,4,4a,5,6,7,8,11,12,12a-dodecahydro-9,12a,13,13-tetramethyl-4-methylene-, 3,8,11,12-tetraacetate, (3S,4aR,6R,8S,11R,12R,12aR)-
Description:
6,10-Methanobenzocyclodecene-3,8,11,12-tetrol, with the CAS number 19605-80-2, is a complex organic compound characterized by its unique bicyclic structure that incorporates both a methanobenzene and cyclodecene framework. This compound features multiple hydroxyl (–OH) groups, indicating it has significant potential for hydrogen bonding, which can influence its solubility and reactivity. The presence of acetate groups suggests that it can undergo esterification reactions, making it versatile in synthetic applications. The stereochemistry, denoted by the specific configuration at various chiral centers, plays a crucial role in determining the compound's biological activity and interaction with other molecules. Its structural complexity and functional groups may contribute to its potential use in pharmaceuticals or as a biochemical probe. Overall, this compound exemplifies the intricate nature of organic molecules, where small changes in structure can lead to significant variations in properties and applications.
Formula:C28H40O8
InChI:InChI=1S/C28H40O8/c1-14-21-12-20-13-23(34-17(4)30)15(2)24(27(20,7)8)25(35-18(5)31)26(36-19(6)32)28(21,9)11-10-22(14)33-16(3)29/h20-23,25-26H,1,10-13H2,2-9H3/t20-,21-,22+,23+,25-,26+,28-/m1/s1
InChI key:InChIKey=SKJSIVQEPKBFTJ-HUWILPJBSA-N
SMILES:C[C@]12[C@@H](OC(C)=O)[C@H](OC(C)=O)C=3C(C)(C)[C@](C[C@@]1(C(=C)[C@@H](OC(C)=O)CC2)[H])(C[C@H](OC(C)=O)C3C)[H]
Synonyms:- 6,10-Methanobenzocyclodecene-3,8,11,12-tetrol, 1,2,3,4,4a,5,6,7,8,11,12,12a-dodecahydro-9,12a,13,13-tetramethyl-4-methylene-, 3,8,11,12-tetraacetate, (3S,4aR,6R,8S,11R,12R,12aR)-
- Taxusin
- 6,10-Methanobenzocyclodecene-3,8,11,12-tetrol, 1,2,3,4,4a,5,6,7,8,11,12,12a-dodecahydro-9,12a,13,13-tetramethyl-4-methylene-, tetraacetate, (3S,4aR,6R,8S,11R,12R,12aR)-
- 6,10-Methanobenzocyclodecene-3,8,11,12-tetrol, 1,2,3,4,4a,5,6,7,8,11,12,12a-dodecahydro-9,12a,13,13-tetramethyl-4-methylene-, tetraacetate, (4aS-(4aalpha,6alpha,9beta,12abeta))-
- 6,10-Methanobenzocyclodecene-3,8,11,12-tetrol, 1,2,3,4,4a,5,6,7,8,11,12,12a-dodecahydro-9,12a,13,13-tetramethyl-4-methylene-, tetraacetate, [3S-(3α,4aα,6β,8α,11β,12α,12aβ)]-
- (5alpha,9alpha,10beta,13alpha)-taxa-4(20),11-diene-5,9,10,13-tetrayl tetraacetate
- Taxa-4(20),11-diene-5α,9α,10β,13α-tetrol, tetraacetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
TAXUSIN
CAS:TAXUSIN is a natural product of the yew tree and has certain anticancer and analgesic activities.Cost-effective and quality-assured.Formula:C28H40O8Purity:99.16% - 99.7%Color and Shape:SolidMolecular weight:504.61Taxusin
CAS:Taxusin is a natural alkaloid compound, which is a type of diterpene ester derived from the bark of yew trees, specifically from the genus Taxus. This compound is typically extracted through specific organic synthesis processes or direct isolation from yew species. Its mode of action lies in its ability to interfere with the microtubule dynamics in cells, crucially inhibiting the mitotic spindle formation necessary for cell division. This disruption induces cell cycle arrest in the G2/M phase, leading to apoptosis, particularly in rapidly dividing cells.Formula:C28H40O8Purity:Min. 95%Molecular weight:504.60 g/mol


