CAS 1961-72-4: (±)-3-Hydroxytetradecanoic acid
Description:(±)-3-Hydroxytetradecanoic acid, also known as 3-hydroxymyristic acid, is a fatty acid characterized by a long hydrocarbon chain with a hydroxyl group (-OH) located at the third carbon position. This compound has a total of 14 carbon atoms, making it a medium-chain fatty acid. It is typically found in various natural sources, including certain plant oils and animal fats. The presence of the hydroxyl group imparts unique properties, such as increased solubility in water compared to typical fatty acids, which are primarily hydrophobic. This hydroxyl group also allows for potential applications in the synthesis of surfactants, emulsifiers, and other chemical intermediates. The compound can exist as a racemic mixture, containing both enantiomers, which may exhibit different biological activities. Its melting point and solubility characteristics can vary based on the specific isomer and environmental conditions. Overall, (±)-3-Hydroxytetradecanoic acid is of interest in both biochemical research and industrial applications due to its structural features and functional properties.
Formula:C14H28O3
InChI:InChI=1S/C14H28O3/c1-2-3-4-5-6-7-8-9-10-11-13(15)12-14(16)17/h13,15H,2-12H2,1H3,(H,16,17)
InChI key:InChIKey=ATRNZOYKSNPPBF-UHFFFAOYSA-N
SMILES:O=C(O)CC(O)CCCCCCCCCCC
- Synonyms:
- (3RS)-3-Hydroxytetradecanoic acid
- (RS)-3-Hydroxytetradecanoic acid
- 3-Hydroxymyristic acid
- 3-Hydroxytetradecanoic acid
- Brn 1725372
- Tetradecanoic acid, 3-hydroxy-
- beta-Hydroxymyristic acid
- beta-Hydroxytetradecanoic acid
- β-Hydroxymyristic acid
- β-Hydroxytetradecanoic acid
- See more synonyms
- 3-03-00-00660 (Beilstein Handbook Reference)
