CAS 19625-79-7
:4-Methoxy-N,N-dimethylbenzeneacetamide
Description:
4-Methoxy-N,N-dimethylbenzeneacetamide, also known by its CAS number 19625-79-7, is an organic compound characterized by its aromatic structure and functional groups. It features a methoxy group (-OCH3) attached to a benzene ring, which contributes to its chemical properties and reactivity. The presence of the N,N-dimethylamide group indicates that it has two methyl groups attached to the nitrogen atom, enhancing its solubility in organic solvents. This compound is typically a white to off-white solid at room temperature and is known for its potential applications in pharmaceuticals and chemical synthesis. Its molecular structure suggests it may exhibit moderate polarity, influencing its interactions with other substances. Additionally, the methoxy group can affect the compound's electronic properties, potentially impacting its biological activity. As with many organic compounds, safety data should be consulted for handling and usage, as it may pose health risks if not managed properly. Overall, 4-Methoxy-N,N-dimethylbenzeneacetamide is a compound of interest in various chemical research fields.
Formula:C11H15NO2
InChI:InChI=1S/C11H15NO2/c1-12(2)11(13)8-9-4-6-10(14-3)7-5-9/h4-7H,8H2,1-3H3
InChI key:InChIKey=ZPEKXVLJLVTMBD-UHFFFAOYSA-N
SMILES:C(C(N(C)C)=O)C1=CC=C(OC)C=C1
Synonyms:- 2-(4-Methoxy Phenyl) N,N-Dimethyl Acetamide (Kg Level)
- 2-(4-Methoxy Phenyl)N,N-Dimethyl Acetamide
- 2-(4-methoxyphenyl)-N,N-dimethylacetamide
- 4-Methoxy-N,N-dimethylbenzeneacetamide
- Acetamide, 2-(p-methoxyphenyl)-N,N-dimethyl-
- Benzeneacetamide, 4-methoxy-N,N-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
