CAS 1962928-22-8

3-[4-[2-[5-(3,5-Dimethyl-4-isoxazolyl)-1-[2-(4-morpholinyl)ethyl]-1H-benzimidazol-2-yl]ethyl]phenoxy]-N,N-dimethyl-1-propanamine

Description:

The chemical substance with the name "3-[4-[2-[5-(3,5-Dimethyl-4-isoxazolyl)-1-[2-(4-morpholinyl)ethyl]-1H-benzimidazol-2-yl]ethyl]phenoxy]-N,N-dimethyl-1-propanamine" and CAS number 1962928-22-8 is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as isoxazole, benzimidazole, and morpholine. This compound is likely to exhibit properties typical of small organic molecules, including potential biological activity, given its structural components that are often associated with pharmacological effects. The presence of dimethyl and morpholine groups suggests it may interact with biological targets, possibly influencing neurotransmitter systems or other cellular pathways. Its solubility, stability, and reactivity would depend on the specific arrangement of its functional groups and the overall molecular conformation. As with many synthetic organic compounds, its safety profile, including toxicity and environmental impact, would need to be assessed through appropriate studies. Overall, this compound represents a class of molecules that may have applications in medicinal chemistry or drug development.

Formula: C₃₁H₄₁N₅O₃

InChI: InChI=1S/C31H41N5O3/c1-23-31(24(2)39-33-23)26-9-12-29-28(22-26)32-30(36(29)16-15-35-17-20-37-21-18-35)13-8-25-6-10-27(11-7-25)38-19-5-14-34(3)4/h6-7,9-12,22H,5,8,13-21H2,1-4H3

InChI key: InChIKey=HCDQWCDANVEBQR-UHFFFAOYSA-N

SMILES: C(CN1CCOCC1)N2C=3C(N=C2CCC4=CC=C(OCCCN(C)C)C=C4)=CC(=CC3)C=5C(C)=NOC5C

Synonyms:

• 1-Propanamine, 3-[4-[2-[5-(3,5-dimethyl-4-isoxazolyl)-1-[2-(4-morpholinyl)ethyl]-1H-benzimidazol-2-yl]ethyl]phenoxy]-N,N-dimethyl-
• 3-[4-[2-[5-(3,5-Dimethyl-4-isoxazolyl)-1-[2-(4-morpholinyl)ethyl]-1H-benzimidazol-2-yl]ethyl]phenoxy]-N,N-dimethyl-1-propanamine
• ISOX DUAL
• [3-[4-[2-[5-(DimethyL-1,2-oxazoL-4-yl)-1-[2-(morpholin-4-yl)ethyl]-1H-1,3-benzodiazol-2-yl] ethyl] phenoxy]propyl]dimethylamine

3-[4-[2-[5-(3,5-Dimethyl-1,2-oxazol-4-yl)-1-(2-morpholin-4-ylethyl)benzimidazol-2-yl]ethyl]phenoxy]-N,N-dimethylpropan-1-amine

Controlled Product

CAS: 1962928-22-8

Tocilizumab is a monoclonal antibody that inhibits the effects of TNF-α, IL-6, and IL-8. It prevents the activation of the downstream inflammatory genes, which are involved in the pathogenesis of cancer and other diseases. Tocilizumab binds to bromodomains on proteins such as p-tefb, which is involved in transcriptional regulation and deuterated Tocilizumab can be used to normalize inflammatory gene expression. This drug has been shown to be effective against aneurysms and other conditions caused by inflammation.

Formula: C₃₁H₄₁N₅O₃

Purity: Min. 95%

Molecular weight: 531.7 g/mol

Ref: 3D-MDD92822

MDK8228

CAS: 1962928-22-8

MDK8228 is an inhibitor of CBP/p300 and BRD4 bromodomain. MDK8228 downregulates IL-6, IL-ß and IFN-ß in macrophages.

Formula: C₃₁H₄₁N₅O₃

Color and Shape: Solid

Molecular weight: 531.69

Ref: TM-T28004