CAS 1964-77-8

5-BROMO-2-METHYL-1H-BENZIMIDAZOLE

Description:

5-Bromo-2-methyl-1H-benzimidazole is a heterocyclic organic compound characterized by its fused benzene and imidazole rings. The presence of a bromine atom at the 5-position and a methyl group at the 2-position of the benzimidazole structure contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents and limited solubility in water, which is common for many benzimidazole derivatives. It is known for its potential biological activities, including antimicrobial and antifungal properties, making it of interest in pharmaceutical research. The molecular structure allows for various chemical modifications, which can enhance its biological efficacy or alter its physicochemical properties. Additionally, 5-bromo-2-methyl-1H-benzimidazole can participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions, making it a versatile building block in organic synthesis. Safety data should be consulted, as halogenated compounds can pose environmental and health risks.

Formula: C₈H₇BrN₂

InChI: InChI=1/C8H7BrN2/c1-5-10-7-3-2-6(9)4-8(7)11-5/h2-4H,1H3,(H,10,11)

SMILES: Cc1nc2ccc(cc2[nH]1)Br

Synonyms:

• 5-Bromo-2-Methyl-1H-Benzo[D]Imidazole
• 5-Bromo-2-Methylbenzimidazole
• 5-Bromo-2-Methyl-1H-Benz(D)Imidazole
• 6-bromo-2-methyl-1H-benzimidazole

5-Bromo-2-methylbenzoimidazole

CAS: 1964-77-8

Formula: C₈H₇BrN₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 211.0586

Ref: IN-DA00AQ19

5-Bromo-2-Methyl-1H-Benzimidazole

CAS: 1964-77-8

5-Bromo-2-Methyl-1H-Benzimidazole

Purity: 98%

Molecular weight: 211.06g/mol

Ref: 54-OR1011823

5-Bromo-2-methyl-1H-benzo[d]imidazole

CAS: 1964-77-8

Formula: C₈H₇BrN₂

Purity: 95%

Color and Shape: Solid, White powder

Molecular weight: 211.062

Ref: 10-F218358