
CAS 19642-70-7
:1-Methyl-4-[2-(phenylmethyl)phenoxy]piperidine
Description:
1-Methyl-4-[2-(phenylmethyl)phenoxy]piperidine, with the CAS number 19642-70-7, is a chemical compound that belongs to the class of piperidine derivatives. It features a piperidine ring substituted with a methyl group and a phenoxy group, which is further substituted with a phenylmethyl group. This structure contributes to its potential biological activity, making it of interest in medicinal chemistry. The compound is typically characterized by its molecular weight, solubility in organic solvents, and stability under various conditions. It may exhibit properties such as lipophilicity due to the presence of aromatic rings, which can influence its pharmacokinetics and interactions with biological targets. Additionally, the presence of the piperidine moiety may impart certain pharmacological effects, potentially including analgesic or psychoactive properties. As with many organic compounds, its reactivity can be influenced by the functional groups present, making it a candidate for further research in drug development and synthesis.
Formula:C19H23NO
InChI:InChI=1S/C19H23NO/c1-20-13-11-18(12-14-20)21-19-10-6-5-9-17(19)15-16-7-3-2-4-8-16/h2-10,18H,11-15H2,1H3
InChI key:InChIKey=LNIWSXNZGKUXBK-UHFFFAOYSA-N
SMILES:O(C1=C(CC2=CC=CC=C2)C=CC=C1)C3CCN(C)CC3
Synonyms:- 1-Methyl-4-[2-(phenylmethyl)phenoxy]piperidine
- Piperidine, 1-methyl-4-[2-(phenylmethyl)phenoxy]-
- Piperidine, 1-methyl-4-[(α-phenyl-o-tolyl)oxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
H1R ligand-1
CAS:H1R ligand-1 (Compound fragment 1) is a high-affinity ligand for the human histamine H1 receptor (H1R). It can serve as a scaffold for synthesizing a series of derivatives to investigate H1R binding kinetics.Formula:C19H23NOColor and Shape:SolidMolecular weight:281.392
