CAS 1965304-68-0
:2-Fluoro-1-nitro-3,5-bis(trifluoromethyl)benzene
Description:
2-Fluoro-1-nitro-3,5-bis(trifluoromethyl)benzene is an aromatic compound characterized by the presence of a fluorine atom, a nitro group, and two trifluoromethyl groups attached to a benzene ring. The molecular structure features a fluorine substituent at the second position and a nitro group at the first position, with two trifluoromethyl groups located at the third and fifth positions of the benzene ring. This compound is notable for its high electronegativity due to the presence of multiple fluorine atoms, which can significantly influence its reactivity and physical properties. It is likely to exhibit high thermal stability and may be insoluble or poorly soluble in water, while being soluble in organic solvents. The presence of the nitro group suggests potential applications in the synthesis of other chemical compounds or materials, particularly in the fields of pharmaceuticals or agrochemicals. Additionally, the trifluoromethyl groups can enhance lipophilicity, making the compound of interest in various chemical research applications.
Formula:C8H2F7NO2
InChI:InChI=1S/C8H2F7NO2/c9-6-4(8(13,14)15)1-3(7(10,11)12)2-5(6)16(17)18/h1-2H
InChI key:InChIKey=JSSGSVZQTIHVSB-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(F)C(N(=O)=O)=CC(C(F)(F)F)=C1
Synonyms:- 2-Fluoro-1-nitro-3,5-bis(trifluoromethyl)benzene
- Benzene, 2-fluoro-1-nitro-3,5-bis(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Fluoro-1-nitro-3,5-bis(trifluoromethyl)benzene
CAS:Formula:C8H2F7NO2Color and Shape:No data available.Molecular weight:277.098
