CAS 1965309-23-2: Pyridazine, 3-bromo-6-ethyl-, hydrobromide (1:1)
Description:Pyridazine, 3-bromo-6-ethyl-, hydrobromide (1:1) is a chemical compound characterized by its pyridazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of a bromine atom at the 3-position and an ethyl group at the 6-position contributes to its unique reactivity and properties. As a hydrobromide salt, it exists in a protonated form, which enhances its solubility in polar solvents, making it useful in various chemical applications. This compound may exhibit biological activity, potentially serving as a precursor in pharmaceutical synthesis or as a reagent in organic chemistry. Its molecular structure allows for various substitution reactions, making it a versatile intermediate in synthetic pathways. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling procedures should be followed. Overall, pyridazine derivatives are of interest in medicinal chemistry due to their diverse biological activities and potential therapeutic applications.
Formula:C6H7BrN2·BrH
InChI:InChI=1S/C6H7BrN2.BrH/c1-2-5-3-4-6(7)9-8-5;/h3-4H,2H2,1H3;1H
InChI key:InChIKey=XTAXSDSMEZYCEH-UHFFFAOYSA-N
SMILES:Br.BrC1=NN=C(C=C1)CC
- Synonyms:
- 3-Bromo-6-ethylpyridazine hydrobromide
- Pyridazine, 3-bromo-6-ethyl-, hydrobromide (1:1)
