CAS 1965309-27-6: Azetidine, 3-(cyclobutyloxy)-, hydrochloride (1:1)

Description:Azetidine, 3-(cyclobutyloxy)-, hydrochloride (1:1) is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocyclic compound containing one nitrogen atom. The presence of the cyclobutyloxy group indicates that a cyclobutane moiety is attached via an ether linkage, contributing to the compound's unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its bioavailability in pharmaceutical applications. The compound may exhibit various biological activities, making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, and it may be studied for its pharmacological effects. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Overall, Azetidine, 3-(cyclobutyloxy)-, hydrochloride (1:1) represents a specific class of organic compounds with potential applications in drug development and research.

Formula:C₇H₁₃NO·ClH

InChI:InChI=1S/C7H13NO.ClH/c1-2-6(3-1)9-7-4-8-5-7;/h6-8H,1-5H2;1H

InChI key:InChIKey=BPNHICOGXFEQKY-UHFFFAOYSA-N

SMILES:Cl.O(C1CNC1)C2CCC2