CAS 1965309-30-1

Quinoline, 6-bromo-7-fluoro-1,2,3,4-tetrahydro-, hydrochloride (1:1)

Description:

Quinoline, 6-bromo-7-fluoro-1,2,3,4-tetrahydro-, hydrochloride (1:1) is a chemical compound characterized by its bicyclic structure, which includes a quinoline moiety. This compound features a bromine atom at the 6-position and a fluorine atom at the 7-position of the quinoline ring, contributing to its unique reactivity and potential biological activity. The tetrahydro form indicates that the compound has undergone partial hydrogenation, resulting in a saturated ring structure that may influence its solubility and stability. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. The presence of halogen substituents often enhances the compound's interaction with biological targets, making it of interest in medicinal chemistry. Overall, this compound's specific structural features suggest potential utility in drug development, particularly in the search for new therapeutic agents.

Formula: C₉H₉BrFN·ClH

InChI: InChI=1S/C9H9BrFN.ClH/c10-7-4-6-2-1-3-12-9(6)5-8(7)11;/h4-5,12H,1-3H2;1H

InChI key: InChIKey=DKGKSUGWUJIJLL-UHFFFAOYSA-N

SMILES: BrC=1C=C2C(=CC1F)NCCC2.Cl

Synonyms:

• Quinoline, 6-bromo-7-fluoro-1,2,3,4-tetrahydro-, hydrochloride (1:1)

6-Bromo-7-fluoro-1,2,3,4-tetrahydro-quinoline hydrochloride

CAS: 1965309-30-1

Versatile small molecule scaffold

Formula: C₉H₁₀BrClFN

Purity: Min. 95%

Molecular weight: 266.54 g/mol

Ref: 3D-QDD30930