CAS 1965309-45-8

2,6-Diazaspiro[3.5]nonane-2-carboxylic acid, 1,1-dimethylethyl ester, hydrochloride (1:1)

Description:

2,6-Diazaspiro[3.5]nonane-2-carboxylic acid, 1,1-dimethylethyl ester, hydrochloride (1:1) is a chemical compound characterized by its spirocyclic structure, which includes a bicyclic framework containing nitrogen atoms. This compound features a carboxylic acid moiety that is esterified with a tert-butyl group, enhancing its lipophilicity and potentially influencing its biological activity. The hydrochloride salt form indicates that the compound is protonated, which can improve its solubility in aqueous environments, making it suitable for various applications, including pharmaceutical formulations. The presence of nitrogen in the structure suggests potential interactions with biological targets, possibly influencing its pharmacological properties. As with many nitrogen-containing compounds, it may exhibit unique reactivity and stability profiles. Overall, this compound's specific characteristics, including its molecular weight, solubility, and reactivity, would be essential for understanding its potential applications in medicinal chemistry and related fields.

Formula: C₁₂H₂₂N₂O₂·ClH

InChI: InChI=1S/C12H22N2O2.ClH/c1-11(2,3)16-10(15)14-8-12(9-14)5-4-6-13-7-12;/h13H,4-9H2,1-3H3;1H

InChI key: InChIKey=AQLWPMSBSJZMIE-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CC2(C1)CCCNC2.Cl

Synonyms:

• 2,6-Diazaspiro[3.5]nonane-2-carboxylic acid, 1,1-dimethylethyl ester, hydrochloride (1:1)

tert-Butyl 2,6-diazaspiro[3.5]nonane-2-carboxylate hydrochloride

CAS: 1965309-45-8

Formula: C₁₂H₂₃ClN₂O₂

Purity: 95%

Molecular weight: 262.7762

Ref: IN-DA01K059

2-Boc-2,6-diaza-spiro[3.5]nonane hydrochloride

CAS: 1965309-45-8

2-Boc-2,6-diaza-spiro[3.5]nonane hydrochloride

Purity: 95%

Ref: 54-OR1038193

2-Boc-2,6-diaza-spiro[3.5]nonane hydrochloride

CAS: 1965309-45-8

Purity: 95%

Molecular weight: 262.7799988

Ref: 10-F736192