CAS 1965309-49-2

Thiazole, 2-(2-pyrrolidinyl)-, hydrochloride (1:2)

Description:

Thiazole, 2-(2-pyrrolidinyl)-, hydrochloride (1:2) is a chemical compound characterized by its thiazole ring structure, which is a five-membered heterocyclic compound containing both sulfur and nitrogen atoms. The presence of the pyrrolidine moiety indicates that it has a saturated five-membered ring containing nitrogen, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its bioavailability for pharmaceutical applications. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its specific interactions and mechanisms of action would depend on its structural features and the functional groups present. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Further research and characterization would be necessary to fully understand its properties, potential applications, and any associated risks.

Formula: C₇H₁₀N₂S·2ClH

InChI: InChI=1S/C7H10N2S.2ClH/c1-2-6(8-3-1)7-9-4-5-10-7;;/h4-6,8H,1-3H2;2*1H

InChI key: InChIKey=GQYINDHFBHMDDN-UHFFFAOYSA-N

SMILES: C1(CCCN1)C2=NC=CS2.Cl

Synonyms:

• Thiazole, 2-(2-pyrrolidinyl)-, hydrochloride (1:2)

2-Pyrrolidin-2-yl-thiazole dihydrochloride

CAS: 1965309-49-2

Versatile small molecule scaffold

Formula: C₇H₁₂Cl₂N₂S

Purity: Min. 95%

Molecular weight: 227.15 g/mol

Ref: 3D-QDD30949