CAS 1965309-61-8

2-Pyridineethanamine, α-methyl-, hydrochloride (1:2)

Description:

2-Pyridineethanamine, α-methyl-, hydrochloride (1:2), also known by its CAS number 1965309-61-8, is a chemical compound characterized by its structure, which includes a pyridine ring and an ethylamine moiety with a methyl group at the alpha position. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The presence of the pyridine ring contributes to its basicity and potential for forming hydrogen bonds, making it a candidate for various chemical reactions and applications in pharmaceuticals and organic synthesis. Its hydrochloride form indicates that it is a protonated amine, which can influence its reactivity and interaction with biological systems. As with many amines, it may exhibit properties such as being a potential neurotransmitter or a precursor in the synthesis of more complex organic molecules. Safety data should be consulted for handling and usage, as with all chemical substances.

Formula: C₈H₁₂N₂·2ClH

InChI: InChI=1S/C8H12N2.2ClH/c1-7(9)6-8-4-2-3-5-10-8;;/h2-5,7H,6,9H2,1H3;2*1H

InChI key: InChIKey=VGEDVDWUZLIFKJ-UHFFFAOYSA-N

SMILES: C(C(C)N)C1=CC=CC=N1.Cl

Synonyms:

• 2-Pyridineethanamine, α-methyl-, hydrochloride (1:2)

1-Methyl-2-pyridin-2-yl-ethylamine Dihydrochloride

Controlled Product

CAS: 1965309-61-8

Formula: C₈H₁₂N₂·2(HCl)

Color and Shape: Neat

Molecular weight: 209.11

Ref: TR-M337978