CAS 1965309-65-2

1H-Pyrazolo[3,4-c]pyridin-7-amine, hydrochloride (1:1)

Description:

1H-Pyrazolo[3,4-c]pyridin-7-amine, hydrochloride (1:1) is a chemical compound characterized by its pyrazolo-pyridine structure, which features a fused pyrazole and pyridine ring system. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it suitable for various applications in medicinal chemistry and drug development. The presence of the amino group at the 7-position of the pyridine ring contributes to its potential biological activity, including interactions with specific receptors or enzymes. The hydrochloride salt form enhances its stability and solubility, facilitating its use in pharmaceutical formulations. As a compound of interest, it may exhibit properties such as anti-inflammatory, analgesic, or neuroprotective effects, although specific biological activities would depend on further empirical studies. Safety data and handling precautions should be observed, as with all chemical substances, to ensure proper laboratory practices.

Formula: C₆H₆N₄·ClH

InChI: InChI=1S/C6H6N4.ClH/c7-6-5-4(1-2-8-6)3-9-10-5;/h1-3H,(H2,7,8)(H,9,10);1H

InChI key: InChIKey=QNWSABAYVBUIFD-UHFFFAOYSA-N

SMILES: NC1=C2C(=CC=N1)C=NN2.Cl

Synonyms:

• 1H-Pyrazolo[3,4-c]pyridin-7-amine, hydrochloride (1:1)