CAS 1965310-09-1

1,1-Dimethylethyl 6-fluoro-2,3-dihydro-3-hydroxyspiro[1H-indene-1,4′-piperidine]-1′-carboxylate

Description:

1,1-Dimethylethyl 6-fluoro-2,3-dihydro-3-hydroxyspiro[1H-indene-1,4′-piperidine]-1′-carboxylate, identified by its CAS number 1965310-09-1, is a chemical compound characterized by its complex structure, which includes a spirocyclic framework. This compound features a piperidine ring and an indene moiety, contributing to its unique chemical properties. The presence of a fluoro group enhances its reactivity and may influence its biological activity. Additionally, the hydroxy group suggests potential for hydrogen bonding, which can affect solubility and interaction with biological targets. The tert-butyl group (1,1-dimethylethyl) is known for providing steric hindrance, which can impact the compound's conformation and stability. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. However, specific details regarding its physical properties, such as melting point, boiling point, and solubility, would require empirical data or literature references for comprehensive understanding.

Formula: C₁₈H₂₄FNO₃

InChI: InChI=1S/C18H24FNO3/c1-17(2,3)23-16(22)20-8-6-18(7-9-20)11-15(21)13-5-4-12(19)10-14(13)18/h4-5,10,15,21H,6-9,11H2,1-3H3

InChI key: InChIKey=NIWRKVCIELMQRN-UHFFFAOYSA-N

SMILES: OC1CC2(C=3C1=CC=C(F)C3)CCN(C(OC(C)(C)C)=O)CC2

Synonyms:

• 1,1-Dimethylethyl 6-fluoro-2,3-dihydro-3-hydroxyspiro[1H-indene-1,4′-piperidine]-1′-carboxylate
• Spiro[1H-indene-1,4′-piperidine]-1′-carboxylic acid, 6-fluoro-2,3-dihydro-3-hydroxy-, 1,1-dimethylethyl ester